C25H32N4O6 — CID 94832225
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]propanediamide (PubChem CID 94832225) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 94832225 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(E)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]propanediamide |
| SMILES | COc1ccc(CCNC(=O)CC(=O)N/N=C/c2ccc(OCC(=O)NC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C25H32N4O6/c1-17(2)28-25(32)16-35-20-8-5-19(6-9-20)15-27-29-24(31)14-23(30)26-12-11-18-7-10-21(33-3)22(13-18)34-4/h5-10,13,15,17H,11-12,14,16H2,1-4H3,(H,26,30)(H,28,32)(H,29,31)/b27-15+ |
| InChIKey | NEMHUEIFBZGBAI-JFLMPSFJSA-N |
| XLogP | 1.81 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|