C30H34N4O8 — CID 126161113
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126161113) has the molecular formula C30H34N4O8 and a molecular weight of 578.62 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126161113 |
| Molecular Formula | C30H34N4O8 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(Z)-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCCc2ccc(OC)c(OC)c2)ccc1OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H34N4O8/c1-5-41-27-17-21(7-13-25(27)42-19-28(35)33-22-8-10-23(38-2)11-9-22)18-32-34-30(37)29(36)31-15-14-20-6-12-24(39-3)26(16-20)40-4/h6-13,16-18H,5,14-15,19H2,1-4H3,(H,31,36)(H,33,35)(H,34,37)/b32-18- |
| InChIKey | KPMCWKVRRZKTFC-CAQPMQTCSA-N |
| XLogP | 2.94 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|