C17H21F3N4O3 — CID 126182261
N-(3-morpholin-4-ylpropyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide (PubChem CID 126182261) has the molecular formula C17H21F3N4O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126182261 |
| Molecular Formula | C17H21F3N4O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)N/N=C\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O3/c18-17(19,20)14-5-2-1-4-13(14)12-22-23-16(26)15(25)21-6-3-7-24-8-10-27-11-9-24/h1-2,4-5,12H,3,6-11H2,(H,21,25)(H,23,26)/b22-12- |
| InChIKey | WLLGXHCNRKXIKE-UUYOSTAYSA-N |
| XLogP | 0.99 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|