C12H16N2O4S — CID 47049367
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]propanamide (PubChem CID 47049367) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]propanamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]propanamide |
|---|---|
| PubChem CID | 47049367 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(N2CCCS2(=O)=O)ccc1O |
| InChI | InChI=1S/C12H16N2O4S/c1-2-12(16)13-10-8-9(4-5-11(10)15)14-6-3-7-19(14,17)18/h4-5,8,15H,2-3,6-7H2,1H3,(H,13,16) |
| InChIKey | WKISTHLDXPQOKX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|