C18H20N2O4S — CID 47049370
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(4-methylphenyl)acetamide (PubChem CID 47049370) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 47049370 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2cc(N3CCCS3(=O)=O)ccc2O)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-13-3-5-14(6-4-13)11-18(22)19-16-12-15(7-8-17(16)21)20-9-2-10-25(20,23)24/h3-8,12,21H,2,9-11H2,1H3,(H,19,22) |
| InChIKey | XWXLGPCSAJSNRC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|