C19H21N3O5S — CID 55815050
N-[2-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyanilino]-2-oxoethyl]-2-methylbenzamide (PubChem CID 55815050) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[2-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyanilino]-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-[2-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyanilino]-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55815050 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[2-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyanilino]-2-oxoethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NCC(=O)Nc1cc(N2CCCS2(=O)=O)ccc1O |
| InChI | InChI=1S/C19H21N3O5S/c1-13-5-2-3-6-15(13)19(25)20-12-18(24)21-16-11-14(7-8-17(16)23)22-9-4-10-28(22,26)27/h2-3,5-8,11,23H,4,9-10,12H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | QCTURWSIDKFJKN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|