C20H21N3O4S — CID 55815176
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 55815176) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 55815176 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-hydroxyphenyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(CCc1c[nH]c2ccccc12)Nc1cc(N2CCCS2(=O)=O)ccc1O |
| InChI | InChI=1S/C20H21N3O4S/c24-19-8-7-15(23-10-3-11-28(23,26)27)12-18(19)22-20(25)9-6-14-13-21-17-5-2-1-4-16(14)17/h1-2,4-5,7-8,12-13,21,24H,3,6,9-11H2,(H,22,25) |
| InChIKey | KBOSFTUEIODLIM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|