C13H18ClN3O3S — CID 22689828
(2S)-2-amino-N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]propanamide (PubChem CID 22689828) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]propanamide.
| Compound Name | (2S)-2-amino-N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 22689828 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2S)-2-amino-N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]propanamide |
| SMILES | C[C@H](N)C(=O)Nc1ccc(N2CCCCS2(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-9(15)13(18)16-10-4-5-12(11(14)8-10)17-6-2-3-7-21(17,19)20/h4-5,8-9H,2-3,6-7,15H2,1H3,(H,16,18)/t9-/m0/s1 |
| InChIKey | KRHPDSPKECEHCT-VIFPVBQESA-N |
| XLogP | 1.56 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |