C17H18ClN3O3S — CID 112505387
1-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-phenylurea (PubChem CID 112505387) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is 1-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 112505387 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(N2CCCCS2(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3S/c18-15-12-14(20-17(22)19-13-6-2-1-3-7-13)8-9-16(15)21-10-4-5-11-25(21,23)24/h1-3,6-9,12H,4-5,10-11H2,(H2,19,20,22) |
| InChIKey | QWDWPFPWYOKPEF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |