C26H21Cl2N3O3S — CID 90130370
3-chloro-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide (PubChem CID 90130370) has the molecular formula C26H21Cl2N3O3S and a molecular weight of 526.45 g/mol. Its IUPAC name is 3-chloro-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide.
| Compound Name | 3-chloro-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide |
|---|---|
| PubChem CID | 90130370 |
| Molecular Formula | C26H21Cl2N3O3S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 3-chloro-N-(4-chloro-3-isoquinolin-1-ylphenyl)-4-(1,1-dioxothiazinan-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nccc3ccccc23)c1)c1ccc(N2CCCCS2(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2N3O3S/c27-22-9-8-19(16-21(22)25-20-6-2-1-5-17(20)11-12-29-25)30-26(32)18-7-10-24(23(28)15-18)31-13-3-4-14-35(31,33)34/h1-2,5-12,15-16H,3-4,13-14H2,(H,30,32) |
| InChIKey | ZWALJUVMDWTXPS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |