C24H18FN3O3S — CID 118462918
4-(1,1-dioxothiazetidin-2-yl)-N-(4-fluoro-3-isoquinolin-1-ylphenyl)benzamide (PubChem CID 118462918) has the molecular formula C24H18FN3O3S and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-(1,1-dioxothiazetidin-2-yl)-N-(4-fluoro-3-isoquinolin-1-ylphenyl)benzamide.
| Compound Name | 4-(1,1-dioxothiazetidin-2-yl)-N-(4-fluoro-3-isoquinolin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 118462918 |
| Molecular Formula | C24H18FN3O3S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-(1,1-dioxothiazetidin-2-yl)-N-(4-fluoro-3-isoquinolin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(-c2nccc3ccccc23)c1)c1ccc(N2CCS2(=O)=O)cc1 |
| InChI | InChI=1S/C24H18FN3O3S/c25-22-10-7-18(15-21(22)23-20-4-2-1-3-16(20)11-12-26-23)27-24(29)17-5-8-19(9-6-17)28-13-14-32(28,30)31/h1-12,15H,13-14H2,(H,27,29) |
| InChIKey | WSJSGCCSROWTLY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |