C14H19ClN2O5S2 — CID 110622893
N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-methylsulfonylpropanamide (PubChem CID 110622893) has the molecular formula C14H19ClN2O5S2 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110622893 |
| Molecular Formula | C14H19ClN2O5S2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[3-chloro-4-(1,1-dioxothiazinan-2-yl)phenyl]-3-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)CCC(=O)Nc1ccc(N2CCCCS2(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O5S2/c1-23(19,20)9-6-14(18)16-11-4-5-13(12(15)10-11)17-7-2-3-8-24(17,21)22/h4-5,10H,2-3,6-9H2,1H3,(H,16,18) |
| InChIKey | CKXCUXQQRRXJQA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |