C18H22N2O4S — CID 110303557
N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-(furan-2-yl)propanamide (PubChem CID 110303557) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110303557 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]-3-(furan-2-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCc2ccco2)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C18H22N2O4S/c1-14-13-15(19-18(21)9-7-16-5-4-11-24-16)6-8-17(14)20-10-2-3-12-25(20,22)23/h4-6,8,11,13H,2-3,7,9-10,12H2,1H3,(H,19,21) |
| InChIKey | KBKUPLYRFPKVAJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |