C19H28N2O3S — CID 110353562
2-cyclopentyl-N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]propanamide (PubChem CID 110353562) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-cyclopentyl-N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]propanamide.
| Compound Name | 2-cyclopentyl-N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]propanamide |
|---|---|
| PubChem CID | 110353562 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-cyclopentyl-N-[4-(1,1-dioxothiazinan-2-yl)-3-methylphenyl]propanamide |
| SMILES | Cc1cc(NC(=O)C(C)C2CCCC2)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C19H28N2O3S/c1-14-13-17(20-19(22)15(2)16-7-3-4-8-16)9-10-18(14)21-11-5-6-12-25(21,23)24/h9-10,13,15-16H,3-8,11-12H2,1-2H3,(H,20,22) |
| InChIKey | KEVAJFUVVLCOLI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |