C20H25N3O3S — CID 7658997
N-[4-(dimethylamino)phenyl]-4-(1,1-dioxothiazinan-2-yl)-3-methylbenzamide (PubChem CID 7658997) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-(1,1-dioxothiazinan-2-yl)-3-methylbenzamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-(1,1-dioxothiazinan-2-yl)-3-methylbenzamide |
|---|---|
| PubChem CID | 7658997 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-(1,1-dioxothiazinan-2-yl)-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N(C)C)cc2)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C20H25N3O3S/c1-15-14-16(6-11-19(15)23-12-4-5-13-27(23,25)26)20(24)21-17-7-9-18(10-8-17)22(2)3/h6-11,14H,4-5,12-13H2,1-3H3,(H,21,24) |
| InChIKey | UNENCAXTXSLTDJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|