C15H17N3O3S2 — CID 7685953
4-(1,1-dioxothiazinan-2-yl)-3-methyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 7685953) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-3-methyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-3-methyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7685953 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-3-methyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2nccs2)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C15H17N3O3S2/c1-11-10-12(14(19)17-15-16-6-8-22-15)4-5-13(11)18-7-2-3-9-23(18,20)21/h4-6,8,10H,2-3,7,9H2,1H3,(H,16,17,19) |
| InChIKey | INACUNFDRFTVRK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |