C12H11N3O3S — CID 87845278
[2-methyl-4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamic acid (PubChem CID 87845278) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is [2-methyl-4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamic acid.
| Compound Name | [2-methyl-4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 87845278 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [2-methyl-4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamic acid |
| SMILES | Cc1cc(C(=O)Nc2nccs2)ccc1NC(=O)O |
| InChI | InChI=1S/C12H11N3O3S/c1-7-6-8(2-3-9(7)14-12(17)18)10(16)15-11-13-4-5-19-11/h2-6,14H,1H3,(H,17,18)(H,13,15,16) |
| InChIKey | PDTMSORGTPDKNK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |