C20H21N3OS — CID 175248146
3-methyl-4-(3-phenylpropylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 175248146) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 3-methyl-4-(3-phenylpropylamino)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-methyl-4-(3-phenylpropylamino)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 175248146 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-methyl-4-(3-phenylpropylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2nccs2)ccc1NCCCc1ccccc1 |
| InChI | InChI=1S/C20H21N3OS/c1-15-14-17(19(24)23-20-22-12-13-25-20)9-10-18(15)21-11-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-10,12-14,21H,5,8,11H2,1H3,(H,22,23,24) |
| InChIKey | HHYCGLPRQDCBJD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|