C12H9N3O2S — CID 110765316
2-methyl-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-carboxamide (PubChem CID 110765316) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-methyl-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | 2-methyl-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110765316 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-methyl-N-(1,3-thiazol-2-yl)-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3nccs3)cc2o1 |
| InChI | InChI=1S/C12H9N3O2S/c1-7-14-9-3-2-8(6-10(9)17-7)11(16)15-12-13-4-5-18-12/h2-6H,1H3,(H,13,15,16) |
| InChIKey | OKACTVJIUNYZLH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |