C20H23N3O4S — CID 7517052
N-(4-acetamidophenyl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide (PubChem CID 7517052) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide.
| Compound Name | N-(4-acetamidophenyl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 7517052 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(4-acetamidophenyl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccc(C)c(N3CCCCS3(=O)=O)c2)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-14-5-6-16(13-19(14)23-11-3-4-12-28(23,26)27)20(25)22-18-9-7-17(8-10-18)21-15(2)24/h5-10,13H,3-4,11-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | OVLRLOOXXGSYGI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |