C19H20N4O3S — CID 7640667
N-(1H-benzimidazol-2-yl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide (PubChem CID 7640667) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 7640667 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-3-(1,1-dioxothiazinan-2-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc3ccccc3[nH]2)cc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C19H20N4O3S/c1-13-8-9-14(12-17(13)23-10-4-5-11-27(23,25)26)18(24)22-19-20-15-6-2-3-7-16(15)21-19/h2-3,6-9,12H,4-5,10-11H2,1H3,(H2,20,21,22,24) |
| InChIKey | GQISTXFITVDPKY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |