C12H17NO4S2 — CID 170820859
1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170820859) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820859 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | O=S1(=O)CCCN1c1cccc(C(O)C(O)CS)c1 |
| InChI | InChI=1S/C12H17NO4S2/c14-11(8-18)12(15)9-3-1-4-10(7-9)13-5-2-6-19(13,16)17/h1,3-4,7,11-12,14-15,18H,2,5-6,8H2 |
| InChIKey | AJNULTKYDOAXBP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|