C13H18N2O5S — CID 171900157
4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-dihydroxybutanamide (PubChem CID 171900157) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900157 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C13H18N2O5S/c14-12(17)8-11(16)13(18)9-3-1-4-10(7-9)15-5-2-6-21(15,19)20/h1,3-4,7,11,13,16,18H,2,5-6,8H2,(H2,14,17) |
| InChIKey | APQZHSILDAVWNE-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |