C16H21BF3N3O4 — CID 170808518
N-[3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808518) has the molecular formula C16H21BF3N3O4 and a molecular weight of 387.17 g/mol. Its IUPAC name is N-[3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808518 |
| Molecular Formula | C16H21BF3N3O4 |
| Molecular Weight | 387.17 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1c(C(F)(F)F)nc[nH]c1=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H21BF3N3O4/c1-9(24)21-7-10(17-26-14(2,3)15(4,5)27-17)6-11-12(16(18,19)20)22-8-23-13(11)25/h6,8H,7H2,1-5H3,(H,21,24)(H,22,23,25) |
| InChIKey | DPGABLXHTOWSPA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|