C16H22BClN2O4 — CID 170807722
N-[3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807722) has the molecular formula C16H22BClN2O4 and a molecular weight of 352.63 g/mol. Its IUPAC name is N-[3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807722 |
| Molecular Formula | C16H22BClN2O4 |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[3-(5-chloro-2-oxo-1H-pyridin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cc(Cl)c[nH]c1=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H22BClN2O4/c1-10(21)19-8-12(6-11-7-13(18)9-20-14(11)22)17-23-15(2,3)16(4,5)24-17/h6-7,9H,8H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | VDZPYOCFHZTASL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|