C18H25BN2O5S — CID 170805258
methyl 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-aminopyridine-3-carboxylate (PubChem CID 170805258) has the molecular formula C18H25BN2O5S and a molecular weight of 392.29 g/mol. Its IUPAC name is methyl 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-aminopyridine-3-carboxylate.
| Compound Name | methyl 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-aminopyridine-3-carboxylate |
|---|---|
| PubChem CID | 170805258 |
| Molecular Formula | C18H25BN2O5S |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | methyl 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-aminopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C=C(CSC(C)=O)B2OC(C)(C)C(C)(C)O2)cnc1N |
| InChI | InChI=1S/C18H25BN2O5S/c1-11(22)27-10-13(19-25-17(2,3)18(4,5)26-19)7-12-8-14(16(23)24-6)15(20)21-9-12/h7-9H,10H2,1-6H3,(H2,20,21) |
| InChIKey | LCVHSOFZTKVDTG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|