C17H23BO4S2 — CID 170804309
S-[3-(5-acetylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804309) has the molecular formula C17H23BO4S2 and a molecular weight of 366.31 g/mol. Its IUPAC name is S-[3-(5-acetylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(5-acetylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804309 |
| Molecular Formula | C17H23BO4S2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | S-[3-(5-acetylthiophen-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1csc(C(C)=O)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BO4S2/c1-11(19)15-8-13(9-24-15)7-14(10-23-12(2)20)18-21-16(3,4)17(5,6)22-18/h7-9H,10H2,1-6H3 |
| InChIKey | QBBIFXYWHQPEMG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|