C19H22BF5O4S — CID 170805551
S-[3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805551) has the molecular formula C19H22BF5O4S and a molecular weight of 452.25 g/mol. Its IUPAC name is S-[3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805551 |
| Molecular Formula | C19H22BF5O4S |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | S-[3-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1ccc(OC(F)(F)C(F)(F)F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H22BF5O4S/c1-12(26)30-11-14(20-28-16(2,3)17(4,5)29-20)10-13-6-8-15(9-7-13)27-19(24,25)18(21,22)23/h6-10H,11H2,1-5H3 |
| InChIKey | OQWRMNCEOGSSHW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|