C14H21BN2O4S — CID 170806407
methyl 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate (PubChem CID 170806407) has the molecular formula C14H21BN2O4S and a molecular weight of 324.21 g/mol. Its IUPAC name is methyl 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 170806407 |
| Molecular Formula | C14H21BN2O4S |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | methyl 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C=C(CN)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C14H21BN2O4S/c1-13(2)14(3,4)21-15(20-13)9(7-16)6-11-17-10(8-22-11)12(18)19-5/h6,8H,7,16H2,1-5H3 |
| InChIKey | YCLILWWRXJBPOW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|