C23H29BN2O4 — CID 170812344
benzyl N-[3-(3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812344) has the molecular formula C23H29BN2O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is benzyl N-[3-(3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812344 |
| Molecular Formula | C23H29BN2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | benzyl N-[3-(3-methyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1cnccc1C=C(CNC(=O)OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H29BN2O4/c1-17-14-25-12-11-19(17)13-20(24-29-22(2,3)23(4,5)30-24)15-26-21(27)28-16-18-9-7-6-8-10-18/h6-14H,15-16H2,1-5H3,(H,26,27) |
| InChIKey | IONJQTQVNWMYBX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|