C21H24BCl2N3O4 — CID 170812526
benzyl N-[3-(2,4-dichloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812526) has the molecular formula C21H24BCl2N3O4 and a molecular weight of 464.16 g/mol. Its IUPAC name is benzyl N-[3-(2,4-dichloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2,4-dichloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812526 |
| Molecular Formula | C21H24BCl2N3O4 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | benzyl N-[3-(2,4-dichloropyrimidin-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cnc(Cl)nc2Cl)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C21H24BCl2N3O4/c1-20(2)21(3,4)31-22(30-20)16(10-15-11-25-18(24)27-17(15)23)12-26-19(28)29-13-14-8-6-5-7-9-14/h5-11H,12-13H2,1-4H3,(H,26,28) |
| InChIKey | HUETZOPNSJEMCF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|