C23H26BClN4O4 — CID 170813072
benzyl N-[3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813072) has the molecular formula C23H26BClN4O4 and a molecular weight of 468.75 g/mol. Its IUPAC name is benzyl N-[3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813072 |
| Molecular Formula | C23H26BClN4O4 |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | benzyl N-[3-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2c[nH]c3c(Cl)ncnc23)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H26BClN4O4/c1-22(2)23(3,4)33-24(32-22)17(10-16-11-26-19-18(16)28-14-29-20(19)25)12-27-21(30)31-13-15-8-6-5-7-9-15/h5-11,14,26H,12-13H2,1-4H3,(H,27,30) |
| InChIKey | UKPNYIXDBNDXQI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|