C26H28BClN2O4 — CID 170813499
benzyl N-[3-(2-chloroquinolin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813499) has the molecular formula C26H28BClN2O4 and a molecular weight of 478.79 g/mol. Its IUPAC name is benzyl N-[3-(2-chloroquinolin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2-chloroquinolin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813499 |
| Molecular Formula | C26H28BClN2O4 |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | benzyl N-[3-(2-chloroquinolin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc3ccccc3nc2Cl)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H28BClN2O4/c1-25(2)26(3,4)34-27(33-25)21(16-29-24(31)32-17-18-10-6-5-7-11-18)15-20-14-19-12-8-9-13-22(19)30-23(20)28/h5-15H,16-17H2,1-4H3,(H,29,31) |
| InChIKey | WVXALLRINCKKTJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|