C24H26BClN2O4S — CID 170813060
benzyl N-[3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813060) has the molecular formula C24H26BClN2O4S and a molecular weight of 484.81 g/mol. Its IUPAC name is benzyl N-[3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813060 |
| Molecular Formula | C24H26BClN2O4S |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | benzyl N-[3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2ccc3nc(Cl)sc3c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H26BClN2O4S/c1-23(2)24(3,4)32-25(31-23)18(12-17-10-11-19-20(13-17)33-21(26)28-19)14-27-22(29)30-15-16-8-6-5-7-9-16/h5-13H,14-15H2,1-4H3,(H,27,29) |
| InChIKey | PZCXKRPSGKMJNV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|