C25H30BNO6 — CID 170813128
benzyl N-[3-(4-formyl-3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813128) has the molecular formula C25H30BNO6 and a molecular weight of 451.33 g/mol. Its IUPAC name is benzyl N-[3-(4-formyl-3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-formyl-3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813128 |
| Molecular Formula | C25H30BNO6 |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | benzyl N-[3-(4-formyl-3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | COc1cc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)ccc1C=O |
| InChI | InChI=1S/C25H30BNO6/c1-24(2)25(3,4)33-26(32-24)21(13-19-11-12-20(16-28)22(14-19)30-5)15-27-23(29)31-17-18-9-7-6-8-10-18/h6-14,16H,15,17H2,1-5H3,(H,27,29) |
| InChIKey | JGUDHAMZZFSRHT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|