C25H30BNO7 — CID 170813384
3-methoxy-4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170813384) has the molecular formula C25H30BNO7 and a molecular weight of 467.33 g/mol. Its IUPAC name is 3-methoxy-4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 3-methoxy-4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170813384 |
| Molecular Formula | C25H30BNO7 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-methoxy-4-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1C=C(CNC(=O)OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H30BNO7/c1-24(2)25(3,4)34-26(33-24)20(13-18-11-12-19(22(28)29)14-21(18)31-5)15-27-23(30)32-16-17-9-7-6-8-10-17/h6-14H,15-16H2,1-5H3,(H,27,30)(H,28,29) |
| InChIKey | OCTJITDKFPLJNW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|