C25H30BClN2O6 — CID 170813850
methyl 2-amino-4-chloro-5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate (PubChem CID 170813850) has the molecular formula C25H30BClN2O6 and a molecular weight of 500.79 g/mol. Its IUPAC name is methyl 2-amino-4-chloro-5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate.
| Compound Name | methyl 2-amino-4-chloro-5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 170813850 |
| Molecular Formula | C25H30BClN2O6 |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | methyl 2-amino-4-chloro-5-[3-(phenylmethoxycarbonylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1cc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)c(Cl)cc1N |
| InChI | InChI=1S/C25H30BClN2O6/c1-24(2)25(3,4)35-26(34-24)18(14-29-23(31)33-15-16-9-7-6-8-10-16)11-17-12-19(22(30)32-5)21(28)13-20(17)27/h6-13H,14-15,28H2,1-5H3,(H,29,31) |
| InChIKey | CQXRRTTUTHUDOG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|