C16H23BF3N3O2 — CID 170815028
3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 170815028) has the molecular formula C16H23BF3N3O2 and a molecular weight of 357.19 g/mol. Its IUPAC name is 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170815028 |
| Molecular Formula | C16H23BF3N3O2 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CNCC(=Cc1cc(C(F)(F)F)cnc1N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BF3N3O2/c1-14(2)15(3,4)25-17(24-14)12(9-22-5)7-10-6-11(16(18,19)20)8-23-13(10)21/h6-8,22H,9H2,1-5H3,(H2,21,23) |
| InChIKey | OXDPTXDHGAKULQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|