C17H26BN3O2 — CID 170814617
3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170814617) has the molecular formula C17H26BN3O2 and a molecular weight of 315.23 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170814617 |
| Molecular Formula | C17H26BN3O2 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1cnc2c(c1)CCN2)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H26BN3O2/c1-16(2)17(3,4)23-18(22-16)14(11-19-5)9-12-8-13-6-7-20-15(13)21-10-12/h8-10,19H,6-7,11H2,1-5H3,(H,20,21) |
| InChIKey | AXHAMAGWGDDECP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|