C22H31BFNO5 — CID 170809895
tert-butyl N-[3-(3-fluoro-2-formyl-6-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170809895) has the molecular formula C22H31BFNO5 and a molecular weight of 419.30 g/mol. Its IUPAC name is tert-butyl N-[3-(3-fluoro-2-formyl-6-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-fluoro-2-formyl-6-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170809895 |
| Molecular Formula | C22H31BFNO5 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | tert-butyl N-[3-(3-fluoro-2-formyl-6-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | Cc1ccc(F)c(C=O)c1C=C(CNC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H31BFNO5/c1-14-9-10-18(24)17(13-26)16(14)11-15(12-25-19(27)28-20(2,3)4)23-29-21(5,6)22(7,8)30-23/h9-11,13H,12H2,1-8H3,(H,25,27) |
| InChIKey | MXPNYKRMMRVLGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|