C15H19BFNO3S — CID 170803162
2-fluoro-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-3-carbaldehyde (PubChem CID 170803162) has the molecular formula C15H19BFNO3S and a molecular weight of 323.20 g/mol. Its IUPAC name is 2-fluoro-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-3-carbaldehyde.
| Compound Name | 2-fluoro-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 170803162 |
| Molecular Formula | C15H19BFNO3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-fluoro-5-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-3-carbaldehyde |
| SMILES | CC1(C)OB(C(=Cc2cnc(F)c(C=O)c2)CS)OC1(C)C |
| InChI | InChI=1S/C15H19BFNO3S/c1-14(2)15(3,4)21-16(20-14)12(9-22)6-10-5-11(8-19)13(17)18-7-10/h5-8,22H,9H2,1-4H3 |
| InChIKey | AJIRFGXTNRSFHS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|