C15H21BFNO3S — CID 170803165
3-(5-fluoro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803165) has the molecular formula C15H21BFNO3S and a molecular weight of 325.21 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(5-fluoro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803165 |
| Molecular Formula | C15H21BFNO3S |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(5-fluoro-2-methoxy-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | COc1ncc(F)cc1C=C(CS)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H21BFNO3S/c1-14(2)15(3,4)21-16(20-14)11(9-22)6-10-7-12(17)8-18-13(10)19-5/h6-8,22H,9H2,1-5H3 |
| InChIKey | VCHSYLJKLRYVIM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|