C15H19BF3NO2S — CID 170803443
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-ene-1-thiol (PubChem CID 170803443) has the molecular formula C15H19BF3NO2S and a molecular weight of 345.20 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-ene-1-thiol.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803443 |
| Molecular Formula | C15H19BF3NO2S |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[4-(trifluoromethyl)-2-pyridinyl]prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cc(C(F)(F)F)ccn2)CS)OC1(C)C |
| InChI | InChI=1S/C15H19BF3NO2S/c1-13(2)14(3,4)22-16(21-13)11(9-23)8-12-7-10(5-6-20-12)15(17,18)19/h5-8,23H,9H2,1-4H3 |
| InChIKey | QBMZWDARGNBIFJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|