C14H15BClF4NO2 — CID 171111882
6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyridine (PubChem CID 171111882) has the molecular formula C14H15BClF4NO2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 171111882 |
| Molecular Formula | C14H15BClF4NO2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-(trifluoromethyl)pyridine |
| SMILES | CC1(C)OB(C(F)=Cc2ccc(Cl)nc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C14H15BClF4NO2/c1-12(2)13(3,4)23-15(22-12)9(17)7-8-5-6-10(16)21-11(8)14(18,19)20/h5-7H,1-4H3 |
| InChIKey | ROOSAQSICWMNBA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|