C15H17BF4N2O2 — CID 171111656
4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-(trifluoromethyl)pyrazole (PubChem CID 171111656) has the molecular formula C15H17BF4N2O2 and a molecular weight of 344.12 g/mol. Its IUPAC name is 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-(trifluoromethyl)pyrazole.
| Compound Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 171111656 |
| Molecular Formula | C15H17BF4N2O2 |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynyl-3-(trifluoromethyl)pyrazole |
| SMILES | C#CCn1cc(C=C(F)B2OC(C)(C)C(C)(C)O2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H17BF4N2O2/c1-6-7-22-9-10(12(21-22)15(18,19)20)8-11(17)16-23-13(2,3)14(4,5)24-16/h1,8-9H,7H2,2-5H3 |
| InChIKey | YQGQSXUDTXHDJB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|