C18H22BFO4 — CID 171110145
2-[1-fluoro-2-(8-methoxy-2H-chromen-3-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110145) has the molecular formula C18H22BFO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is 2-[1-fluoro-2-(8-methoxy-2H-chromen-3-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-fluoro-2-(8-methoxy-2H-chromen-3-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110145 |
| Molecular Formula | C18H22BFO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[1-fluoro-2-(8-methoxy-2H-chromen-3-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1cccc2c1OCC(C=C(F)B1OC(C)(C)C(C)(C)O1)=C2 |
| InChI | InChI=1S/C18H22BFO4/c1-17(2)18(3,4)24-19(23-17)15(20)10-12-9-13-7-6-8-14(21-5)16(13)22-11-12/h6-10H,11H2,1-5H3 |
| InChIKey | DQLHWVBGCUPGDH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|