C14H17NO — CID 43292906
2-(2-ethylphenoxy)cyclopentane-1-carbonitrile (PubChem CID 43292906) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-(2-ethylphenoxy)cyclopentane-1-carbonitrile.
| Compound Name | 2-(2-ethylphenoxy)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 43292906 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(2-ethylphenoxy)cyclopentane-1-carbonitrile |
| SMILES | CCc1ccccc1OC1CCCC1C#N |
| InChI | InChI=1S/C14H17NO/c1-2-11-6-3-4-8-13(11)16-14-9-5-7-12(14)10-15/h3-4,6,8,12,14H,2,5,7,9H2,1H3 |
| InChIKey | YYUADWQXMXHWAQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |