C15H18N2O2 — CID 43292463
2-(2-cyanocycloheptyl)oxybenzamide (PubChem CID 43292463) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(2-cyanocycloheptyl)oxybenzamide.
| Compound Name | 2-(2-cyanocycloheptyl)oxybenzamide |
|---|---|
| PubChem CID | 43292463 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-(2-cyanocycloheptyl)oxybenzamide |
| SMILES | N#CC1CCCCCC1Oc1ccccc1C(N)=O |
| InChI | InChI=1S/C15H18N2O2/c16-10-11-6-2-1-3-8-13(11)19-14-9-5-4-7-12(14)15(17)18/h4-5,7,9,11,13H,1-3,6,8H2,(H2,17,18) |
| InChIKey | JIQBETOTYOGFHR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |