C13H14ClNO — CID 43292471
2-[(2-chlorophenyl)methoxy]cyclopentane-1-carbonitrile (PubChem CID 43292471) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methoxy]cyclopentane-1-carbonitrile.
| Compound Name | 2-[(2-chlorophenyl)methoxy]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 43292471 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[(2-chlorophenyl)methoxy]cyclopentane-1-carbonitrile |
| SMILES | N#CC1CCCC1OCc1ccccc1Cl |
| InChI | InChI=1S/C13H14ClNO/c14-12-6-2-1-4-11(12)9-16-13-7-3-5-10(13)8-15/h1-2,4,6,10,13H,3,5,7,9H2 |
| InChIKey | CNEDFWVNVZGRSN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |