C13H17NO2 — CID 43292120
2-(furan-2-ylmethoxy)cycloheptane-1-carbonitrile (PubChem CID 43292120) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(furan-2-ylmethoxy)cycloheptane-1-carbonitrile.
| Compound Name | 2-(furan-2-ylmethoxy)cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 43292120 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(furan-2-ylmethoxy)cycloheptane-1-carbonitrile |
| SMILES | N#CC1CCCCCC1OCc1ccco1 |
| InChI | InChI=1S/C13H17NO2/c14-9-11-5-2-1-3-7-13(11)16-10-12-6-4-8-15-12/h4,6,8,11,13H,1-3,5,7,10H2 |
| InChIKey | NCYACNLQRGYPJQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |